About 2-hydroxyethyl 2-methylprop-2-enoate;methane;oxepan-2-one
2-hydroxyethyl 2-methylprop-2-enoate;methane;oxepan-2-one (PubChem CID 158521926) has the molecular formula C14H28O5
and a molecular weight of 276.37 g/mol. Its IUPAC name is 2-hydroxyethyl 2-methylprop-2-enoate;methane;oxepan-2-one.
Molecular Properties
| Compound Name | 2-hydroxyethyl 2-methylprop-2-enoate;methane;oxepan-2-one |
| PubChem CID | 158521926 |
| Molecular Formula | C14H28O5 |
| Molecular Weight | 276.37 g/mol |
| Exact Mass | 276.19 |
| IUPAC Name | 2-hydroxyethyl 2-methylprop-2-enoate;methane;oxepan-2-one |
| SMILES | C.C.C=C(C)C(=O)OCCO.O=C1CCCCCO1 |
| InChI | InChI=1S/C6H10O3.C6H10O2.2CH4/c1-5(2)6(8)9-4-3-7;7-6-4-2-1-3-5-8-6;;/h7H,1,3-4H2,2H3;1-5H2;2*1H4 |
| InChIKey | HMHXFSXQRXMTEM-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.37 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxyethyl 2-methylprop-2-enoate;methane;oxepan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxyethyl 2-methylprop-2-enoate;methane;oxepan-2-one?
The IUPAC name of 2-hydroxyethyl 2-methylprop-2-enoate;methane;oxepan-2-one (CID 158521926) is 2-hydroxyethyl 2-methylprop-2-enoate;methane;oxepan-2-one.
What is the SMILES notation for 2-hydroxyethyl 2-methylprop-2-enoate;methane;oxepan-2-one?
The canonical SMILES for 2-hydroxyethyl 2-methylprop-2-enoate;methane;oxepan-2-one is C.C.C=C(C)C(=O)OCCO.O=C1CCCCCO1.
What is the InChIKey of 2-hydroxyethyl 2-methylprop-2-enoate;methane;oxepan-2-one?
The InChIKey is HMHXFSXQRXMTEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O3.C6H10O2.2CH4/c1-5(2)6(8)9-4-3-7;7-6-4-2-1-3-5-8-6;;/h7H,1,3-4H2,2H3;1-5H2;2*1H4.
What are the key properties of 2-hydroxyethyl 2-methylprop-2-enoate;methane;oxepan-2-one?
2-hydroxyethyl 2-methylprop-2-enoate;methane;oxepan-2-one has a molecular weight of 276.37 g/mol, XLogP of 2.47, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxyethyl 2-methylprop-2-enoate;methane;oxepan-2-one is sourced from PubChem (CID 158521926), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).