C12H23O9P — CID 170851537
2-hydroxyethyl 2-methylprop-2-enoate;oxepan-2-one;phosphoric acid (PubChem CID 170851537) has the molecular formula C12H23O9P and a molecular weight of 342.28 g/mol. Its IUPAC name is 2-hydroxyethyl 2-methylprop-2-enoate;oxepan-2-one;phosphoric acid.
| Compound Name | 2-hydroxyethyl 2-methylprop-2-enoate;oxepan-2-one;phosphoric acid |
|---|---|
| PubChem CID | 170851537 |
| Molecular Formula | C12H23O9P |
| Molecular Weight | 342.28 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | 2-hydroxyethyl 2-methylprop-2-enoate;oxepan-2-one;phosphoric acid |
| SMILES | C=C(C)C(=O)OCCO.O=C1CCCCCO1.O=P(O)(O)O |
| InChI | InChI=1S/C6H10O3.C6H10O2.H3O4P/c1-5(2)6(8)9-4-3-7;7-6-4-2-1-3-5-8-6;1-5(2,3)4/h7H,1,3-4H2,2H3;1-5H2;(H3,1,2,3,4) |
| InChIKey | CFCDVOYOQZDRCW-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 150.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.28 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|