C11H16N2O — CID 84664284
2-(1,2,3,4-tetrahydroquinolin-5-yloxy)ethanamine (PubChem CID 84664284) has the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. Its IUPAC name is 2-(1,2,3,4-tetrahydroquinolin-5-yloxy)ethanamine.
| Compound Name | 2-(1,2,3,4-tetrahydroquinolin-5-yloxy)ethanamine |
|---|---|
| PubChem CID | 84664284 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | 2-(1,2,3,4-tetrahydroquinolin-5-yloxy)ethanamine |
| SMILES | NCCOc1cccc2c1CCCN2 |
| InChI | InChI=1S/C11H16N2O/c12-6-8-14-11-5-1-4-10-9(11)3-2-7-13-10/h1,4-5,13H,2-3,6-8,12H2 |
| InChIKey | DBQVJQVMLHKOOA-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |