C17H19N2O4P — CID 23398065
(3E)-6-dimethoxyphosphoryl-3-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-1H-indol-2-one (PubChem CID 23398065) has the molecular formula C17H19N2O4P and a molecular weight of 346.32 g/mol. Its IUPAC name is (3E)-6-dimethoxyphosphoryl-3-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-1H-indol-2-one.
| Compound Name | (3E)-6-dimethoxyphosphoryl-3-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-1H-indol-2-one |
|---|---|
| PubChem CID | 23398065 |
| Molecular Formula | C17H19N2O4P |
| Molecular Weight | 346.32 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | (3E)-6-dimethoxyphosphoryl-3-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-1H-indol-2-one |
| SMILES | COP(=O)(OC)c1ccc2c(c1)NC(=O)/C2=C/c1[nH]c(C)cc1C |
| InChI | InChI=1S/C17H19N2O4P/c1-10-7-11(2)18-15(10)9-14-13-6-5-12(24(21,22-3)23-4)8-16(13)19-17(14)20/h5-9,18H,1-4H3,(H,19,20)/b14-9+ |
| InChIKey | NZIVCMSLSBPYHJ-NTEUORMPSA-N |
| XLogP | 3.24 |
| TPSA | 80.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.32 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|