C20H22NO7P — CID 59079675
(3Z)-6-dimethoxyphosphoryl-3-[(2,3,5-trimethoxyphenyl)methylidene]-1H-indol-2-one (PubChem CID 59079675) has the molecular formula C20H22NO7P and a molecular weight of 419.37 g/mol. Its IUPAC name is (3Z)-6-dimethoxyphosphoryl-3-[(2,3,5-trimethoxyphenyl)methylidene]-1H-indol-2-one.
| Compound Name | (3Z)-6-dimethoxyphosphoryl-3-[(2,3,5-trimethoxyphenyl)methylidene]-1H-indol-2-one |
|---|---|
| PubChem CID | 59079675 |
| Molecular Formula | C20H22NO7P |
| Molecular Weight | 419.37 g/mol |
| Exact Mass | 419.11 |
| IUPAC Name | (3Z)-6-dimethoxyphosphoryl-3-[(2,3,5-trimethoxyphenyl)methylidene]-1H-indol-2-one |
| SMILES | COc1cc(/C=C2\C(=O)Nc3cc(P(=O)(OC)OC)ccc32)c(OC)c(OC)c1 |
| InChI | InChI=1S/C20H22NO7P/c1-24-13-8-12(19(26-3)18(10-13)25-2)9-16-15-7-6-14(29(23,27-4)28-5)11-17(15)21-20(16)22/h6-11H,1-5H3,(H,21,22)/b16-9- |
| InChIKey | QSECAMINCAKWLP-SXGWCWSVSA-N |
| XLogP | 3.32 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.37 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|