C22H18NNaO4Se — CID 173119357
sodium;hydride;5-[[6-(4-methoxyphenyl)-2-oxo-1H-indol-3-ylidene]methyl]-2-methylselenophene-3-carboxylic acid (PubChem CID 173119357) has the molecular formula C22H18NNaO4Se and a molecular weight of 462.34 g/mol. Its IUPAC name is sodium;hydride;5-[[6-(4-methoxyphenyl)-2-oxo-1H-indol-3-ylidene]methyl]-2-methylselenophene-3-carboxylic acid.
| Compound Name | sodium;hydride;5-[[6-(4-methoxyphenyl)-2-oxo-1H-indol-3-ylidene]methyl]-2-methylselenophene-3-carboxylic acid |
|---|---|
| PubChem CID | 173119357 |
| Molecular Formula | C22H18NNaO4Se |
| Molecular Weight | 462.34 g/mol |
| Exact Mass | 463.03 |
| IUPAC Name | sodium;hydride;5-[[6-(4-methoxyphenyl)-2-oxo-1H-indol-3-ylidene]methyl]-2-methylselenophene-3-carboxylic acid |
| SMILES | COc1ccc(-c2ccc3c(c2)NC(=O)C3=Cc2cc(C(=O)O)c(C)[se]2)cc1.[H-].[Na+] |
| InChI | InChI=1S/C22H17NO4Se.Na.H/c1-12-18(22(25)26)10-16(28-12)11-19-17-8-5-14(9-20(17)23-21(19)24)13-3-6-15(27-2)7-4-13;;/h3-11H,1-2H3,(H,23,24)(H,25,26);;/q;+1;-1 |
| InChIKey | NINUFOURHSNMKY-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.34 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|