C22H27N3O3 — CID 143765912
N-ethyl-N-[2-[5-[(Z)-(5-methoxy-2-oxo-1H-indol-3-ylidene)methyl]-3,4-dimethyl-1H-pyrrol-2-yl]ethyl]acetamide (PubChem CID 143765912) has the molecular formula C22H27N3O3 and a molecular weight of 381.48 g/mol. Its IUPAC name is N-ethyl-N-[2-[5-[(Z)-(5-methoxy-2-oxo-1H-indol-3-ylidene)methyl]-3,4-dimethyl-1H-pyrrol-2-yl]ethyl]acetamide.
| Compound Name | N-ethyl-N-[2-[5-[(Z)-(5-methoxy-2-oxo-1H-indol-3-ylidene)methyl]-3,4-dimethyl-1H-pyrrol-2-yl]ethyl]acetamide |
|---|---|
| PubChem CID | 143765912 |
| Molecular Formula | C22H27N3O3 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | N-ethyl-N-[2-[5-[(Z)-(5-methoxy-2-oxo-1H-indol-3-ylidene)methyl]-3,4-dimethyl-1H-pyrrol-2-yl]ethyl]acetamide |
| SMILES | CCN(CCc1[nH]c(/C=C2\C(=O)Nc3ccc(OC)cc32)c(C)c1C)C(C)=O |
| InChI | InChI=1S/C22H27N3O3/c1-6-25(15(4)26)10-9-19-13(2)14(3)21(23-19)12-18-17-11-16(28-5)7-8-20(17)24-22(18)27/h7-8,11-12,23H,6,9-10H2,1-5H3,(H,24,27)/b18-12- |
| InChIKey | OHSHLZWEXNQITP-PDGQHHTCSA-N |
| XLogP | 3.54 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|