C27H34N4O6 — CID 126705792
[(3Z)-3-[[4-[2-(diethylamino)ethylcarbamoyl]-3,5-dimethyl-1H-pyrrol-2-yl]methylidene]-2-oxo-1H-indol-5-yl] (2S)-2-acetyloxypropanoate (PubChem CID 126705792) has the molecular formula C27H34N4O6 and a molecular weight of 510.59 g/mol. Its IUPAC name is [(3Z)-3-[[4-[2-(diethylamino)ethylcarbamoyl]-3,5-dimethyl-1H-pyrrol-2-yl]methylidene]-2-oxo-1H-indol-5-yl] (2S)-2-acetyloxypropanoate.
| Compound Name | [(3Z)-3-[[4-[2-(diethylamino)ethylcarbamoyl]-3,5-dimethyl-1H-pyrrol-2-yl]methylidene]-2-oxo-1H-indol-5-yl] (2S)-2-acetyloxypropanoate |
|---|---|
| PubChem CID | 126705792 |
| Molecular Formula | C27H34N4O6 |
| Molecular Weight | 510.59 g/mol |
| Exact Mass | 510.25 |
| IUPAC Name | [(3Z)-3-[[4-[2-(diethylamino)ethylcarbamoyl]-3,5-dimethyl-1H-pyrrol-2-yl]methylidene]-2-oxo-1H-indol-5-yl] (2S)-2-acetyloxypropanoate |
| SMILES | CCN(CC)CCNC(=O)c1c(C)[nH]c(/C=C2\C(=O)Nc3ccc(OC(=O)[C@H](C)OC(C)=O)cc32)c1C |
| InChI | InChI=1S/C27H34N4O6/c1-7-31(8-2)12-11-28-26(34)24-15(3)23(29-16(24)4)14-21-20-13-19(9-10-22(20)30-25(21)33)37-27(35)17(5)36-18(6)32/h9-10,13-14,17,29H,7-8,11-12H2,1-6H3,(H,28,34)(H,30,33)/b21-14-/t17-/m0/s1 |
| InChIKey | INKBOTXQCWXWAR-XESZTULISA-N |
| XLogP | 3.05 |
| TPSA | 129.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.59 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|