C29H40N4O6 — CID 134215533
N-[2-(diethylamino)ethyl]-2,4-dimethyl-5-[(Z)-[2-oxo-5-[2-[2-(2-oxopropoxy)ethoxy]ethoxy]-1H-indol-3-ylidene]methyl]-1H-pyrrole-3-carboxamide (PubChem CID 134215533) has the molecular formula C29H40N4O6 and a molecular weight of 540.66 g/mol. Its IUPAC name is N-[2-(diethylamino)ethyl]-2,4-dimethyl-5-[(Z)-[2-oxo-5-[2-[2-(2-oxopropoxy)ethoxy]ethoxy]-1H-indol-3-ylidene]methyl]-1H-pyrrole-3-carboxamide.
| Compound Name | N-[2-(diethylamino)ethyl]-2,4-dimethyl-5-[(Z)-[2-oxo-5-[2-[2-(2-oxopropoxy)ethoxy]ethoxy]-1H-indol-3-ylidene]methyl]-1H-pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 134215533 |
| Molecular Formula | C29H40N4O6 |
| Molecular Weight | 540.66 g/mol |
| Exact Mass | 540.29 |
| IUPAC Name | N-[2-(diethylamino)ethyl]-2,4-dimethyl-5-[(Z)-[2-oxo-5-[2-[2-(2-oxopropoxy)ethoxy]ethoxy]-1H-indol-3-ylidene]methyl]-1H-pyrrole-3-carboxamide |
| SMILES | CCN(CC)CCNC(=O)c1c(C)[nH]c(/C=C2\C(=O)Nc3ccc(OCCOCCOCC(C)=O)cc32)c1C |
| InChI | InChI=1S/C29H40N4O6/c1-6-33(7-2)11-10-30-29(36)27-20(4)26(31-21(27)5)17-24-23-16-22(8-9-25(23)32-28(24)35)39-15-14-37-12-13-38-18-19(3)34/h8-9,16-17,31H,6-7,10-15,18H2,1-5H3,(H,30,36)(H,32,35)/b24-17- |
| InChIKey | UEEWKJNDYSACLM-ULJHMMPZSA-N |
| XLogP | 3.20 |
| TPSA | 121.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.66 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|