C18H19N3O3 — CID 78015916
5-methoxy-3-[[2-(oxan-4-yl)-1H-imidazol-5-yl]methylidene]-1H-indol-2-one (PubChem CID 78015916) has the molecular formula C18H19N3O3 and a molecular weight of 325.37 g/mol. Its IUPAC name is 5-methoxy-3-[[2-(oxan-4-yl)-1H-imidazol-5-yl]methylidene]-1H-indol-2-one.
| Compound Name | 5-methoxy-3-[[2-(oxan-4-yl)-1H-imidazol-5-yl]methylidene]-1H-indol-2-one |
|---|---|
| PubChem CID | 78015916 |
| Molecular Formula | C18H19N3O3 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | 5-methoxy-3-[[2-(oxan-4-yl)-1H-imidazol-5-yl]methylidene]-1H-indol-2-one |
| SMILES | COc1ccc2c(c1)C(=Cc1cnc(C3CCOCC3)[nH]1)C(=O)N2 |
| InChI | InChI=1S/C18H19N3O3/c1-23-13-2-3-16-14(9-13)15(18(22)21-16)8-12-10-19-17(20-12)11-4-6-24-7-5-11/h2-3,8-11H,4-7H2,1H3,(H,19,20)(H,21,22) |
| InChIKey | FGCXDELHWPLMMG-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|