C30H26O4 — CID 102593165
(3Z)-3-[(3,4-dimethoxyphenyl)methylidene]-6-methoxy-1,1-diphenyl-2-benzofuran (PubChem CID 102593165) has the molecular formula C30H26O4 and a molecular weight of 450.53 g/mol. Its IUPAC name is (3Z)-3-[(3,4-dimethoxyphenyl)methylidene]-6-methoxy-1,1-diphenyl-2-benzofuran.
| Compound Name | (3Z)-3-[(3,4-dimethoxyphenyl)methylidene]-6-methoxy-1,1-diphenyl-2-benzofuran |
|---|---|
| PubChem CID | 102593165 |
| Molecular Formula | C30H26O4 |
| Molecular Weight | 450.53 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | (3Z)-3-[(3,4-dimethoxyphenyl)methylidene]-6-methoxy-1,1-diphenyl-2-benzofuran |
| SMILES | COc1ccc2c(c1)C(c1ccccc1)(c1ccccc1)O/C2=C\c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C30H26O4/c1-31-24-15-16-25-26(20-24)30(22-10-6-4-7-11-22,23-12-8-5-9-13-23)34-28(25)18-21-14-17-27(32-2)29(19-21)33-3/h4-20H,1-3H3/b28-18- |
| InChIKey | YRVHGZDNDQIJGZ-VEILYXNESA-N |
| XLogP | 6.53 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.53 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|