C23H22O4S — CID 102593163
(3Z)-3-[(3,4-dimethoxyphenyl)methylidene]-6-methoxy-1-methyl-1-thiophen-2-yl-2-benzofuran (PubChem CID 102593163) has the molecular formula C23H22O4S and a molecular weight of 394.49 g/mol. Its IUPAC name is (3Z)-3-[(3,4-dimethoxyphenyl)methylidene]-6-methoxy-1-methyl-1-thiophen-2-yl-2-benzofuran.
| Compound Name | (3Z)-3-[(3,4-dimethoxyphenyl)methylidene]-6-methoxy-1-methyl-1-thiophen-2-yl-2-benzofuran |
|---|---|
| PubChem CID | 102593163 |
| Molecular Formula | C23H22O4S |
| Molecular Weight | 394.49 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | (3Z)-3-[(3,4-dimethoxyphenyl)methylidene]-6-methoxy-1-methyl-1-thiophen-2-yl-2-benzofuran |
| SMILES | COc1ccc2c(c1)C(C)(c1cccs1)O/C2=C\c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C23H22O4S/c1-23(22-6-5-11-28-22)18-14-16(24-2)8-9-17(18)20(27-23)12-15-7-10-19(25-3)21(13-15)26-4/h5-14H,1-4H3/b20-12- |
| InChIKey | PJZCQTWATZEKSO-NDENLUEZSA-N |
| XLogP | 5.57 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.49 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|