C24H24O5S — CID 15358081
3-(3,4-dimethoxyphenyl)-6,7-dimethoxy-1-methyl-1-thiophen-2-ylisochromene (PubChem CID 15358081) has the molecular formula C24H24O5S and a molecular weight of 424.52 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-6,7-dimethoxy-1-methyl-1-thiophen-2-ylisochromene.
| Compound Name | 3-(3,4-dimethoxyphenyl)-6,7-dimethoxy-1-methyl-1-thiophen-2-ylisochromene |
|---|---|
| PubChem CID | 15358081 |
| Molecular Formula | C24H24O5S |
| Molecular Weight | 424.52 g/mol |
| Exact Mass | 424.13 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-6,7-dimethoxy-1-methyl-1-thiophen-2-ylisochromene |
| SMILES | COc1ccc(C2=Cc3cc(OC)c(OC)cc3C(C)(c3cccs3)O2)cc1OC |
| InChI | InChI=1S/C24H24O5S/c1-24(23-7-6-10-30-23)17-14-22(28-5)21(27-4)13-16(17)12-19(29-24)15-8-9-18(25-2)20(11-15)26-3/h6-14H,1-5H3 |
| InChIKey | JOCXUJHGGSZROL-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.52 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|