C28H30O5 — CID 132779363
3-(3,4-diethoxyphenyl)-6,7-dimethoxy-1-methyl-1-phenylisochromene (PubChem CID 132779363) has the molecular formula C28H30O5 and a molecular weight of 446.54 g/mol. Its IUPAC name is 3-(3,4-diethoxyphenyl)-6,7-dimethoxy-1-methyl-1-phenylisochromene.
| Compound Name | 3-(3,4-diethoxyphenyl)-6,7-dimethoxy-1-methyl-1-phenylisochromene |
|---|---|
| PubChem CID | 132779363 |
| Molecular Formula | C28H30O5 |
| Molecular Weight | 446.54 g/mol |
| Exact Mass | 446.21 |
| IUPAC Name | 3-(3,4-diethoxyphenyl)-6,7-dimethoxy-1-methyl-1-phenylisochromene |
| SMILES | CCOc1ccc(C2=Cc3cc(OC)c(OC)cc3C(C)(c3ccccc3)O2)cc1OCC |
| InChI | InChI=1S/C28H30O5/c1-6-31-23-14-13-19(15-27(23)32-7-2)24-16-20-17-25(29-4)26(30-5)18-22(20)28(3,33-24)21-11-9-8-10-12-21/h8-18H,6-7H2,1-5H3 |
| InChIKey | DSIZXGUWLSUZLQ-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.54 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|