C22H24O6 — CID 15548266
2-[3-(4-ethoxyphenyl)-6,7-dimethoxy-1-methylisochromen-1-yl]acetic acid (PubChem CID 15548266) has the molecular formula C22H24O6 and a molecular weight of 384.43 g/mol. Its IUPAC name is 2-[3-(4-ethoxyphenyl)-6,7-dimethoxy-1-methylisochromen-1-yl]acetic acid.
| Compound Name | 2-[3-(4-ethoxyphenyl)-6,7-dimethoxy-1-methylisochromen-1-yl]acetic acid |
|---|---|
| PubChem CID | 15548266 |
| Molecular Formula | C22H24O6 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | 2-[3-(4-ethoxyphenyl)-6,7-dimethoxy-1-methylisochromen-1-yl]acetic acid |
| SMILES | CCOc1ccc(C2=Cc3cc(OC)c(OC)cc3C(C)(CC(=O)O)O2)cc1 |
| InChI | InChI=1S/C22H24O6/c1-5-27-16-8-6-14(7-9-16)18-10-15-11-19(25-3)20(26-4)12-17(15)22(2,28-18)13-21(23)24/h6-12H,5,13H2,1-4H3,(H,23,24) |
| InChIKey | AZJRXRTXNHSJND-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|