C20H19Cl3O4 — CID 2865752
3-(4-ethoxyphenyl)-6,7-dimethoxy-1-(trichloromethyl)-1H-isochromene (PubChem CID 2865752) has the molecular formula C20H19Cl3O4 and a molecular weight of 429.73 g/mol. Its IUPAC name is 3-(4-ethoxyphenyl)-6,7-dimethoxy-1-(trichloromethyl)-1H-isochromene.
| Compound Name | 3-(4-ethoxyphenyl)-6,7-dimethoxy-1-(trichloromethyl)-1H-isochromene |
|---|---|
| PubChem CID | 2865752 |
| Molecular Formula | C20H19Cl3O4 |
| Molecular Weight | 429.73 g/mol |
| Exact Mass | 428.03 |
| IUPAC Name | 3-(4-ethoxyphenyl)-6,7-dimethoxy-1-(trichloromethyl)-1H-isochromene |
| SMILES | CCOc1ccc(C2=Cc3cc(OC)c(OC)cc3C(C(Cl)(Cl)Cl)O2)cc1 |
| InChI | InChI=1S/C20H19Cl3O4/c1-4-26-14-7-5-12(6-8-14)16-9-13-10-17(24-2)18(25-3)11-15(13)19(27-16)20(21,22)23/h5-11,19H,4H2,1-3H3 |
| InChIKey | FCBORSFOJOYKLE-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.73 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|