C13H13NO5 — CID 100802087
3-(4-ethoxy-3-methoxyphenyl)-1,2-oxazole-4-carboxylic acid (PubChem CID 100802087) has the molecular formula C13H13NO5 and a molecular weight of 263.25 g/mol. Its IUPAC name is 3-(4-ethoxy-3-methoxyphenyl)-1,2-oxazole-4-carboxylic acid.
| Compound Name | 3-(4-ethoxy-3-methoxyphenyl)-1,2-oxazole-4-carboxylic acid |
|---|---|
| PubChem CID | 100802087 |
| Molecular Formula | C13H13NO5 |
| Molecular Weight | 263.25 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | 3-(4-ethoxy-3-methoxyphenyl)-1,2-oxazole-4-carboxylic acid |
| SMILES | CCOc1ccc(-c2nocc2C(=O)O)cc1OC |
| InChI | InChI=1S/C13H13NO5/c1-3-18-10-5-4-8(6-11(10)17-2)12-9(13(15)16)7-19-14-12/h4-7H,3H2,1-2H3,(H,15,16) |
| InChIKey | XWMPYWJIFZYKMZ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 81.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.25 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |