C14H18O2 — CID 23377407
5,6-dimethoxy-1,1,2-trimethylindene (PubChem CID 23377407) has the molecular formula C14H18O2 and a molecular weight of 218.30 g/mol. Its IUPAC name is 5,6-dimethoxy-1,1,2-trimethylindene.
| Compound Name | 5,6-dimethoxy-1,1,2-trimethylindene |
|---|---|
| PubChem CID | 23377407 |
| Molecular Formula | C14H18O2 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | 5,6-dimethoxy-1,1,2-trimethylindene |
| SMILES | COc1cc2c(cc1OC)C(C)(C)C(C)=C2 |
| InChI | InChI=1S/C14H18O2/c1-9-6-10-7-12(15-4)13(16-5)8-11(10)14(9,2)3/h6-8H,1-5H3 |
| InChIKey | ASEWUMJXOFFUJM-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |