C26H22O6 — CID 122210307
1,8-diethyl-17,18-dimethoxypentacyclo[6.6.6.02,7.09,14.015,20]icosa-2,6,9,13,15,17,19-heptaene-4,5,11,12-tetrone (PubChem CID 122210307) has the molecular formula C26H22O6 and a molecular weight of 430.46 g/mol. Its IUPAC name is 1,8-diethyl-17,18-dimethoxypentacyclo[6.6.6.02,7.09,14.015,20]icosa-2,6,9,13,15,17,19-heptaene-4,5,11,12-tetrone.
| Compound Name | 1,8-diethyl-17,18-dimethoxypentacyclo[6.6.6.02,7.09,14.015,20]icosa-2,6,9,13,15,17,19-heptaene-4,5,11,12-tetrone |
|---|---|
| PubChem CID | 122210307 |
| Molecular Formula | C26H22O6 |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.14 |
| IUPAC Name | 1,8-diethyl-17,18-dimethoxypentacyclo[6.6.6.02,7.09,14.015,20]icosa-2,6,9,13,15,17,19-heptaene-4,5,11,12-tetrone |
| SMILES | CCC12C3=CC(=O)C(=O)C=C3C(CC)(C3=CC(=O)C(=O)C=C31)c1cc(OC)c(OC)cc12 |
| InChI | InChI=1S/C26H22O6/c1-5-25-13-7-19(27)21(29)9-15(13)26(6-2,16-10-22(30)20(28)8-14(16)25)18-12-24(32-4)23(31-3)11-17(18)25/h7-12H,5-6H2,1-4H3 |
| InChIKey | SCZANABVRVZBHJ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|