C13H17FO4 — CID 83949927
2-ethyl-2-(2-fluoro-4,5-dimethoxyphenyl)-1,3-dioxolane (PubChem CID 83949927) has the molecular formula C13H17FO4 and a molecular weight of 256.27 g/mol. Its IUPAC name is 2-ethyl-2-(2-fluoro-4,5-dimethoxyphenyl)-1,3-dioxolane.
| Compound Name | 2-ethyl-2-(2-fluoro-4,5-dimethoxyphenyl)-1,3-dioxolane |
|---|---|
| PubChem CID | 83949927 |
| Molecular Formula | C13H17FO4 |
| Molecular Weight | 256.27 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | 2-ethyl-2-(2-fluoro-4,5-dimethoxyphenyl)-1,3-dioxolane |
| SMILES | CCC1(c2cc(OC)c(OC)cc2F)OCCO1 |
| InChI | InChI=1S/C13H17FO4/c1-4-13(17-5-6-18-13)9-7-11(15-2)12(16-3)8-10(9)14/h7-8H,4-6H2,1-3H3 |
| InChIKey | HKMPBPGDBLNHHU-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.27 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |