C17H26O3 — CID 83958354
2-(5-tert-butyl-2-ethoxyphenyl)-2-ethyl-1,3-dioxolane (PubChem CID 83958354) has the molecular formula C17H26O3 and a molecular weight of 278.39 g/mol. Its IUPAC name is 2-(5-tert-butyl-2-ethoxyphenyl)-2-ethyl-1,3-dioxolane.
| Compound Name | 2-(5-tert-butyl-2-ethoxyphenyl)-2-ethyl-1,3-dioxolane |
|---|---|
| PubChem CID | 83958354 |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | 2-(5-tert-butyl-2-ethoxyphenyl)-2-ethyl-1,3-dioxolane |
| SMILES | CCOc1ccc(C(C)(C)C)cc1C1(CC)OCCO1 |
| InChI | InChI=1S/C17H26O3/c1-6-17(19-10-11-20-17)14-12-13(16(3,4)5)8-9-15(14)18-7-2/h8-9,12H,6-7,10-11H2,1-5H3 |
| InChIKey | CHCHIKUAFVBJKZ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |