C16H24O3 — CID 83958921
2-(4-ethoxy-2,3-dimethylphenyl)-2-propyl-1,3-dioxolane (PubChem CID 83958921) has the molecular formula C16H24O3 and a molecular weight of 264.36 g/mol. Its IUPAC name is 2-(4-ethoxy-2,3-dimethylphenyl)-2-propyl-1,3-dioxolane.
| Compound Name | 2-(4-ethoxy-2,3-dimethylphenyl)-2-propyl-1,3-dioxolane |
|---|---|
| PubChem CID | 83958921 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.36 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | 2-(4-ethoxy-2,3-dimethylphenyl)-2-propyl-1,3-dioxolane |
| SMILES | CCCC1(c2ccc(OCC)c(C)c2C)OCCO1 |
| InChI | InChI=1S/C16H24O3/c1-5-9-16(18-10-11-19-16)14-7-8-15(17-6-2)13(4)12(14)3/h7-8H,5-6,9-11H2,1-4H3 |
| InChIKey | XOENCWBGWNEEIR-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.36 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |