About 2-(5-tert-butyl-2-ethylphenyl)-2-propyl-1,3-dioxolane
2-(5-tert-butyl-2-ethylphenyl)-2-propyl-1,3-dioxolane (PubChem CID 83957578) has the molecular formula C18H28O2
and a molecular weight of 276.42 g/mol. Its IUPAC name is 2-(5-tert-butyl-2-ethylphenyl)-2-propyl-1,3-dioxolane.
Molecular Properties
| Compound Name | 2-(5-tert-butyl-2-ethylphenyl)-2-propyl-1,3-dioxolane |
| PubChem CID | 83957578 |
| Molecular Formula | C18H28O2 |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.21 |
| IUPAC Name | 2-(5-tert-butyl-2-ethylphenyl)-2-propyl-1,3-dioxolane |
| SMILES | CCCC1(c2cc(C(C)(C)C)ccc2CC)OCCO1 |
| InChI | InChI=1S/C18H28O2/c1-6-10-18(19-11-12-20-18)16-13-15(17(3,4)5)9-8-14(16)7-2/h8-9,13H,6-7,10-12H2,1-5H3 |
| InChIKey | FIHIYJHKNMDMLF-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(5-tert-butyl-2-ethylphenyl)-2-propyl-1,3-dioxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-tert-butyl-2-ethylphenyl)-2-propyl-1,3-dioxolane?
The IUPAC name of 2-(5-tert-butyl-2-ethylphenyl)-2-propyl-1,3-dioxolane (CID 83957578) is 2-(5-tert-butyl-2-ethylphenyl)-2-propyl-1,3-dioxolane.
What is the SMILES notation for 2-(5-tert-butyl-2-ethylphenyl)-2-propyl-1,3-dioxolane?
The canonical SMILES for 2-(5-tert-butyl-2-ethylphenyl)-2-propyl-1,3-dioxolane is CCCC1(c2cc(C(C)(C)C)ccc2CC)OCCO1.
What is the InChIKey of 2-(5-tert-butyl-2-ethylphenyl)-2-propyl-1,3-dioxolane?
The InChIKey is FIHIYJHKNMDMLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H28O2/c1-6-10-18(19-11-12-20-18)16-13-15(17(3,4)5)9-8-14(16)7-2/h8-9,13H,6-7,10-12H2,1-5H3.
What are the key properties of 2-(5-tert-butyl-2-ethylphenyl)-2-propyl-1,3-dioxolane?
2-(5-tert-butyl-2-ethylphenyl)-2-propyl-1,3-dioxolane has a molecular weight of 276.42 g/mol, XLogP of 4.55, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-tert-butyl-2-ethylphenyl)-2-propyl-1,3-dioxolane is sourced from PubChem (CID 83957578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).