C18H28O2 — CID 83957578
2-(5-tert-butyl-2-ethylphenyl)-2-propyl-1,3-dioxolane (PubChem CID 83957578) has the molecular formula C18H28O2 and a molecular weight of 276.42 g/mol. Its IUPAC name is 2-(5-tert-butyl-2-ethylphenyl)-2-propyl-1,3-dioxolane.
| Compound Name | 2-(5-tert-butyl-2-ethylphenyl)-2-propyl-1,3-dioxolane |
|---|---|
| PubChem CID | 83957578 |
| Molecular Formula | C18H28O2 |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.21 |
| IUPAC Name | 2-(5-tert-butyl-2-ethylphenyl)-2-propyl-1,3-dioxolane |
| SMILES | CCCC1(c2cc(C(C)(C)C)ccc2CC)OCCO1 |
| InChI | InChI=1S/C18H28O2/c1-6-10-18(19-11-12-20-18)16-13-15(17(3,4)5)9-8-14(16)7-2/h8-9,13H,6-7,10-12H2,1-5H3 |
| InChIKey | FIHIYJHKNMDMLF-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |