C17H25ClO4 — CID 83959353
2-(5-chloro-2,4-dipropoxyphenyl)-2-ethyl-1,3-dioxolane (PubChem CID 83959353) has the molecular formula C17H25ClO4 and a molecular weight of 328.84 g/mol. Its IUPAC name is 2-(5-chloro-2,4-dipropoxyphenyl)-2-ethyl-1,3-dioxolane.
| Compound Name | 2-(5-chloro-2,4-dipropoxyphenyl)-2-ethyl-1,3-dioxolane |
|---|---|
| PubChem CID | 83959353 |
| Molecular Formula | C17H25ClO4 |
| Molecular Weight | 328.84 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | 2-(5-chloro-2,4-dipropoxyphenyl)-2-ethyl-1,3-dioxolane |
| SMILES | CCCOc1cc(OCCC)c(C2(CC)OCCO2)cc1Cl |
| InChI | InChI=1S/C17H25ClO4/c1-4-7-19-15-12-16(20-8-5-2)14(18)11-13(15)17(6-3)21-9-10-22-17/h11-12H,4-10H2,1-3H3 |
| InChIKey | RDVGGYSVWVWNNN-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.84 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |