C15H22O4 — CID 83958722
2-ethyl-2-(3-methoxy-4-propoxyphenyl)-1,3-dioxolane (PubChem CID 83958722) has the molecular formula C15H22O4 and a molecular weight of 266.34 g/mol. Its IUPAC name is 2-ethyl-2-(3-methoxy-4-propoxyphenyl)-1,3-dioxolane.
| Compound Name | 2-ethyl-2-(3-methoxy-4-propoxyphenyl)-1,3-dioxolane |
|---|---|
| PubChem CID | 83958722 |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | 2-ethyl-2-(3-methoxy-4-propoxyphenyl)-1,3-dioxolane |
| SMILES | CCCOc1ccc(C2(CC)OCCO2)cc1OC |
| InChI | InChI=1S/C15H22O4/c1-4-8-17-13-7-6-12(11-14(13)16-3)15(5-2)18-9-10-19-15/h6-7,11H,4-5,8-10H2,1-3H3 |
| InChIKey | PNZWJWUDQSWYEA-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |