C17H14O4S — CID 6509321
(3E)-5-(2,4-dimethoxyphenyl)-3-(thiophen-2-ylmethylidene)furan-2-one (PubChem CID 6509321) has the molecular formula C17H14O4S and a molecular weight of 314.36 g/mol. Its IUPAC name is (3E)-5-(2,4-dimethoxyphenyl)-3-(thiophen-2-ylmethylidene)furan-2-one.
| Compound Name | (3E)-5-(2,4-dimethoxyphenyl)-3-(thiophen-2-ylmethylidene)furan-2-one |
|---|---|
| PubChem CID | 6509321 |
| Molecular Formula | C17H14O4S |
| Molecular Weight | 314.36 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | (3E)-5-(2,4-dimethoxyphenyl)-3-(thiophen-2-ylmethylidene)furan-2-one |
| SMILES | COc1ccc(C2=C/C(=C\c3cccs3)C(=O)O2)c(OC)c1 |
| InChI | InChI=1S/C17H14O4S/c1-19-12-5-6-14(15(10-12)20-2)16-9-11(17(18)21-16)8-13-4-3-7-22-13/h3-10H,1-2H3/b11-8+ |
| InChIKey | QRKCSWHXGCLPAT-DHZHZOJOSA-N |
| XLogP | 3.75 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.36 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|