C27H20O4 — CID 6313006
(3E)-3-(anthracen-9-ylmethylidene)-5-(2,5-dimethoxyphenyl)furan-2-one (PubChem CID 6313006) has the molecular formula C27H20O4 and a molecular weight of 408.45 g/mol. Its IUPAC name is (3E)-3-(anthracen-9-ylmethylidene)-5-(2,5-dimethoxyphenyl)furan-2-one.
| Compound Name | (3E)-3-(anthracen-9-ylmethylidene)-5-(2,5-dimethoxyphenyl)furan-2-one |
|---|---|
| PubChem CID | 6313006 |
| Molecular Formula | C27H20O4 |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | (3E)-3-(anthracen-9-ylmethylidene)-5-(2,5-dimethoxyphenyl)furan-2-one |
| SMILES | COc1ccc(OC)c(C2=C/C(=C\c3c4ccccc4cc4ccccc34)C(=O)O2)c1 |
| InChI | InChI=1S/C27H20O4/c1-29-20-11-12-25(30-2)24(16-20)26-15-19(27(28)31-26)14-23-21-9-5-3-7-17(21)13-18-8-4-6-10-22(18)23/h3-16H,1-2H3/b19-14+ |
| InChIKey | KOUFYWOQSIEVHH-XMHGGMMESA-N |
| XLogP | 5.99 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|