C17H14O5 — CID 782127
5-(2,5-dimethoxyphenyl)-3-(furan-2-ylmethylidene)furan-2-one (PubChem CID 782127) has the molecular formula C17H14O5 and a molecular weight of 298.29 g/mol. Its IUPAC name is 5-(2,5-dimethoxyphenyl)-3-(furan-2-ylmethylidene)furan-2-one.
| Compound Name | 5-(2,5-dimethoxyphenyl)-3-(furan-2-ylmethylidene)furan-2-one |
|---|---|
| PubChem CID | 782127 |
| Molecular Formula | C17H14O5 |
| Molecular Weight | 298.29 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | 5-(2,5-dimethoxyphenyl)-3-(furan-2-ylmethylidene)furan-2-one |
| SMILES | COc1ccc(OC)c(C2=CC(=Cc3ccco3)C(=O)O2)c1 |
| InChI | InChI=1S/C17H14O5/c1-19-12-5-6-15(20-2)14(10-12)16-9-11(17(18)22-16)8-13-4-3-7-21-13/h3-10H,1-2H3 |
| InChIKey | XAKAGYCOHKUGDP-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 57.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.29 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|