C25H14F6O5 — CID 110273982
[(2Z)-2-[(3-fluorophenyl)methylidene]-4-methyl-3-oxo-1-benzofuran-6-yl] 2-(2,3,4,5,6-pentafluorophenoxy)propanoate (PubChem CID 110273982) has the molecular formula C25H14F6O5 and a molecular weight of 508.37 g/mol. Its IUPAC name is [(2Z)-2-[(3-fluorophenyl)methylidene]-4-methyl-3-oxo-1-benzofuran-6-yl] 2-(2,3,4,5,6-pentafluorophenoxy)propanoate.
| Compound Name | [(2Z)-2-[(3-fluorophenyl)methylidene]-4-methyl-3-oxo-1-benzofuran-6-yl] 2-(2,3,4,5,6-pentafluorophenoxy)propanoate |
|---|---|
| PubChem CID | 110273982 |
| Molecular Formula | C25H14F6O5 |
| Molecular Weight | 508.37 g/mol |
| Exact Mass | 508.07 |
| IUPAC Name | [(2Z)-2-[(3-fluorophenyl)methylidene]-4-methyl-3-oxo-1-benzofuran-6-yl] 2-(2,3,4,5,6-pentafluorophenoxy)propanoate |
| SMILES | Cc1cc(OC(=O)C(C)Oc2c(F)c(F)c(F)c(F)c2F)cc2c1C(=O)/C(=C/c1cccc(F)c1)O2 |
| InChI | InChI=1S/C25H14F6O5/c1-10-6-14(9-15-17(10)23(32)16(36-15)8-12-4-3-5-13(26)7-12)35-25(33)11(2)34-24-21(30)19(28)18(27)20(29)22(24)31/h3-9,11H,1-2H3/b16-8- |
| InChIKey | VAZJTDNZWKBAOJ-PXNMLYILSA-N |
| XLogP | 5.82 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.37 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|