C28H21F5O5 — CID 110274044
[(2Z)-2-[(4-tert-butylphenyl)methylidene]-3-oxo-1-benzofuran-6-yl] 2-(2,3,4,5,6-pentafluorophenoxy)propanoate (PubChem CID 110274044) has the molecular formula C28H21F5O5 and a molecular weight of 532.46 g/mol. Its IUPAC name is [(2Z)-2-[(4-tert-butylphenyl)methylidene]-3-oxo-1-benzofuran-6-yl] 2-(2,3,4,5,6-pentafluorophenoxy)propanoate.
| Compound Name | [(2Z)-2-[(4-tert-butylphenyl)methylidene]-3-oxo-1-benzofuran-6-yl] 2-(2,3,4,5,6-pentafluorophenoxy)propanoate |
|---|---|
| PubChem CID | 110274044 |
| Molecular Formula | C28H21F5O5 |
| Molecular Weight | 532.46 g/mol |
| Exact Mass | 532.13 |
| IUPAC Name | [(2Z)-2-[(4-tert-butylphenyl)methylidene]-3-oxo-1-benzofuran-6-yl] 2-(2,3,4,5,6-pentafluorophenoxy)propanoate |
| SMILES | CC(Oc1c(F)c(F)c(F)c(F)c1F)C(=O)Oc1ccc2c(c1)O/C(=C\c1ccc(C(C)(C)C)cc1)C2=O |
| InChI | InChI=1S/C28H21F5O5/c1-13(36-26-23(32)21(30)20(29)22(31)24(26)33)27(35)37-16-9-10-17-18(12-16)38-19(25(17)34)11-14-5-7-15(8-6-14)28(2,3)4/h5-13H,1-4H3/b19-11- |
| InChIKey | GMPJGPVZMIGEDA-ODLFYWEKSA-N |
| XLogP | 6.67 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.46 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|