C23H26ClNO4 — CID 118723603
(2Z)-2-[(4-methoxyphenyl)methylidene]-6-(3-pyrrolidin-1-ylpropoxy)-1-benzofuran-3-one;hydrochloride (PubChem CID 118723603) has the molecular formula C23H26ClNO4 and a molecular weight of 415.92 g/mol. Its IUPAC name is (2Z)-2-[(4-methoxyphenyl)methylidene]-6-(3-pyrrolidin-1-ylpropoxy)-1-benzofuran-3-one;hydrochloride.
| Compound Name | (2Z)-2-[(4-methoxyphenyl)methylidene]-6-(3-pyrrolidin-1-ylpropoxy)-1-benzofuran-3-one;hydrochloride |
|---|---|
| PubChem CID | 118723603 |
| Molecular Formula | C23H26ClNO4 |
| Molecular Weight | 415.92 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | (2Z)-2-[(4-methoxyphenyl)methylidene]-6-(3-pyrrolidin-1-ylpropoxy)-1-benzofuran-3-one;hydrochloride |
| SMILES | COc1ccc(/C=C2\Oc3cc(OCCCN4CCCC4)ccc3C2=O)cc1.Cl |
| InChI | InChI=1S/C23H25NO4.ClH/c1-26-18-7-5-17(6-8-18)15-22-23(25)20-10-9-19(16-21(20)28-22)27-14-4-13-24-11-2-3-12-24;/h5-10,15-16H,2-4,11-14H2,1H3;1H/b22-15-; |
| InChIKey | SAUKWCVAAOSXTN-YNYSCKANSA-N |
| XLogP | 4.60 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.92 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|