C23H16Cl2O3 — CID 2019431
(2Z)-6-[(3,4-dichlorophenyl)methoxy]-2-[(2-methylphenyl)methylidene]-1-benzofuran-3-one (PubChem CID 2019431) has the molecular formula C23H16Cl2O3 and a molecular weight of 411.28 g/mol. Its IUPAC name is (2Z)-6-[(3,4-dichlorophenyl)methoxy]-2-[(2-methylphenyl)methylidene]-1-benzofuran-3-one.
| Compound Name | (2Z)-6-[(3,4-dichlorophenyl)methoxy]-2-[(2-methylphenyl)methylidene]-1-benzofuran-3-one |
|---|---|
| PubChem CID | 2019431 |
| Molecular Formula | C23H16Cl2O3 |
| Molecular Weight | 411.28 g/mol |
| Exact Mass | 410.05 |
| IUPAC Name | (2Z)-6-[(3,4-dichlorophenyl)methoxy]-2-[(2-methylphenyl)methylidene]-1-benzofuran-3-one |
| SMILES | Cc1ccccc1/C=C1\Oc2cc(OCc3ccc(Cl)c(Cl)c3)ccc2C1=O |
| InChI | InChI=1S/C23H16Cl2O3/c1-14-4-2-3-5-16(14)11-22-23(26)18-8-7-17(12-21(18)28-22)27-13-15-6-9-19(24)20(25)10-15/h2-12H,13H2,1H3/b22-11- |
| InChIKey | SBRVRPHIPOZTDH-JJFYIABZSA-N |
| XLogP | 6.50 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.28 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|