C18H13FO5 — CID 6227020
2-[[(2Z)-2-[(2-fluorophenyl)methylidene]-3-oxo-1-benzofuran-6-yl]oxy]propanoic acid (PubChem CID 6227020) has the molecular formula C18H13FO5 and a molecular weight of 328.30 g/mol. Its IUPAC name is 2-[[(2Z)-2-[(2-fluorophenyl)methylidene]-3-oxo-1-benzofuran-6-yl]oxy]propanoic acid.
| Compound Name | 2-[[(2Z)-2-[(2-fluorophenyl)methylidene]-3-oxo-1-benzofuran-6-yl]oxy]propanoic acid |
|---|---|
| PubChem CID | 6227020 |
| Molecular Formula | C18H13FO5 |
| Molecular Weight | 328.30 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | 2-[[(2Z)-2-[(2-fluorophenyl)methylidene]-3-oxo-1-benzofuran-6-yl]oxy]propanoic acid |
| SMILES | CC(Oc1ccc2c(c1)O/C(=C\c1ccccc1F)C2=O)C(=O)O |
| InChI | InChI=1S/C18H13FO5/c1-10(18(21)22)23-12-6-7-13-15(9-12)24-16(17(13)20)8-11-4-2-3-5-14(11)19/h2-10H,1H3,(H,21,22)/b16-8- |
| InChIKey | NKMIJGBEYOBAOT-PXNMLYILSA-N |
| XLogP | 3.29 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.30 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|