C23H14F2O6 — CID 125433228
(2Z,9S)-2-[[2-(difluoromethoxy)phenyl]methylidene]-9-(furan-2-yl)-8,9-dihydrofuro[2,3-f]chromene-3,7-dione (PubChem CID 125433228) has the molecular formula C23H14F2O6 and a molecular weight of 424.36 g/mol. Its IUPAC name is (2Z,9S)-2-[[2-(difluoromethoxy)phenyl]methylidene]-9-(furan-2-yl)-8,9-dihydrofuro[2,3-f]chromene-3,7-dione.
| Compound Name | (2Z,9S)-2-[[2-(difluoromethoxy)phenyl]methylidene]-9-(furan-2-yl)-8,9-dihydrofuro[2,3-f]chromene-3,7-dione |
|---|---|
| PubChem CID | 125433228 |
| Molecular Formula | C23H14F2O6 |
| Molecular Weight | 424.36 g/mol |
| Exact Mass | 424.08 |
| IUPAC Name | (2Z,9S)-2-[[2-(difluoromethoxy)phenyl]methylidene]-9-(furan-2-yl)-8,9-dihydrofuro[2,3-f]chromene-3,7-dione |
| SMILES | O=C1C[C@H](c2ccco2)c2c(ccc3c2O/C(=C\c2ccccc2OC(F)F)C3=O)O1 |
| InChI | InChI=1S/C23H14F2O6/c24-23(25)31-15-5-2-1-4-12(15)10-18-21(27)13-7-8-17-20(22(13)30-18)14(11-19(26)29-17)16-6-3-9-28-16/h1-10,14,23H,11H2/b18-10-/t14-/m1/s1 |
| InChIKey | BBPDAIDAXNIQNY-FNHQQPGVSA-N |
| XLogP | 4.94 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.36 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|