C33H27NO8 — CID 163068405
9-[3-(pyridin-3-ylmethoxy)phenyl]-2-[(2,4,5-trimethoxyphenyl)methylidene]-8,9-dihydrofuro[2,3-f]chromene-3,7-dione (PubChem CID 163068405) has the molecular formula C33H27NO8 and a molecular weight of 565.58 g/mol. Its IUPAC name is 9-[3-(pyridin-3-ylmethoxy)phenyl]-2-[(2,4,5-trimethoxyphenyl)methylidene]-8,9-dihydrofuro[2,3-f]chromene-3,7-dione.
| Compound Name | 9-[3-(pyridin-3-ylmethoxy)phenyl]-2-[(2,4,5-trimethoxyphenyl)methylidene]-8,9-dihydrofuro[2,3-f]chromene-3,7-dione |
|---|---|
| PubChem CID | 163068405 |
| Molecular Formula | C33H27NO8 |
| Molecular Weight | 565.58 g/mol |
| Exact Mass | 565.17 |
| IUPAC Name | 9-[3-(pyridin-3-ylmethoxy)phenyl]-2-[(2,4,5-trimethoxyphenyl)methylidene]-8,9-dihydrofuro[2,3-f]chromene-3,7-dione |
| SMILES | COc1cc(OC)c(OC)cc1C=C1Oc2c(ccc3c2C(c2cccc(OCc4cccnc4)c2)CC(=O)O3)C1=O |
| InChI | InChI=1S/C33H27NO8/c1-37-26-16-28(39-3)27(38-2)13-21(26)14-29-32(36)23-9-10-25-31(33(23)42-29)24(15-30(35)41-25)20-7-4-8-22(12-20)40-18-19-6-5-11-34-17-19/h4-14,16-17,24H,15,18H2,1-3H3 |
| InChIKey | YSHNJWDYQOZVCD-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 102.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.58 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|