C25H14ClFO6 — CID 124848918
4-[(2Z,9R)-2-[(2-chloro-6-fluorophenyl)methylidene]-3,7-dioxo-8,9-dihydrofuro[2,3-f]chromen-9-yl]benzoic acid (PubChem CID 124848918) has the molecular formula C25H14ClFO6 and a molecular weight of 464.83 g/mol. Its IUPAC name is 4-[(2Z,9R)-2-[(2-chloro-6-fluorophenyl)methylidene]-3,7-dioxo-8,9-dihydrofuro[2,3-f]chromen-9-yl]benzoic acid.
| Compound Name | 4-[(2Z,9R)-2-[(2-chloro-6-fluorophenyl)methylidene]-3,7-dioxo-8,9-dihydrofuro[2,3-f]chromen-9-yl]benzoic acid |
|---|---|
| PubChem CID | 124848918 |
| Molecular Formula | C25H14ClFO6 |
| Molecular Weight | 464.83 g/mol |
| Exact Mass | 464.05 |
| IUPAC Name | 4-[(2Z,9R)-2-[(2-chloro-6-fluorophenyl)methylidene]-3,7-dioxo-8,9-dihydrofuro[2,3-f]chromen-9-yl]benzoic acid |
| SMILES | O=C1C[C@H](c2ccc(C(=O)O)cc2)c2c(ccc3c2O/C(=C\c2c(F)cccc2Cl)C3=O)O1 |
| InChI | InChI=1S/C25H14ClFO6/c26-17-2-1-3-18(27)16(17)10-20-23(29)14-8-9-19-22(24(14)33-20)15(11-21(28)32-19)12-4-6-13(7-5-12)25(30)31/h1-10,15H,11H2,(H,30,31)/b20-10-/t15-/m1/s1 |
| InChIKey | NRIPCHBSJKGDBD-RKQRPNFGSA-N |
| XLogP | 5.23 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.83 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|