C25H36O10 — CID 57268701
7-decoxy-4-hydroxy-3-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-2-one (PubChem CID 57268701) has the molecular formula C25H36O10 and a molecular weight of 496.55 g/mol. Its IUPAC name is 7-decoxy-4-hydroxy-3-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-2-one.
| Compound Name | 7-decoxy-4-hydroxy-3-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-2-one |
|---|---|
| PubChem CID | 57268701 |
| Molecular Formula | C25H36O10 |
| Molecular Weight | 496.55 g/mol |
| Exact Mass | 496.23 |
| IUPAC Name | 7-decoxy-4-hydroxy-3-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-2-one |
| SMILES | CCCCCCCCCCOc1ccc2c(O)c(O[C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)c(=O)oc2c1 |
| InChI | InChI=1S/C25H36O10/c1-2-3-4-5-6-7-8-9-12-32-15-10-11-16-17(13-15)33-24(31)23(19(16)27)35-25-22(30)21(29)20(28)18(14-26)34-25/h10-11,13,18,20-22,25-30H,2-9,12,14H2,1H3/t18-,20+,21+,22-,25+/m1/s1 |
| InChIKey | JQRBKBICSKOAPP-INASXULFSA-N |
| XLogP | 2.20 |
| TPSA | 159.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.55 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|