C19H24O10 — CID 54300168
7-butoxy-3-hydroxy-4-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-2-one (PubChem CID 54300168) has the molecular formula C19H24O10 and a molecular weight of 412.39 g/mol. Its IUPAC name is 7-butoxy-3-hydroxy-4-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-2-one.
| Compound Name | 7-butoxy-3-hydroxy-4-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-2-one |
|---|---|
| PubChem CID | 54300168 |
| Molecular Formula | C19H24O10 |
| Molecular Weight | 412.39 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | 7-butoxy-3-hydroxy-4-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-2-one |
| SMILES | CCCCOc1ccc2c(O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O)c(O)c(=O)oc2c1 |
| InChI | InChI=1S/C19H24O10/c1-2-3-6-26-9-4-5-10-11(7-9)27-18(25)16(24)17(10)29-19-15(23)14(22)13(21)12(8-20)28-19/h4-5,7,12-15,19-24H,2-3,6,8H2,1H3/t12-,13-,14+,15+,19-/m1/s1 |
| InChIKey | SDQCVKAOSVMSGL-GUAITYKCSA-N |
| XLogP | -0.14 |
| TPSA | 159.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.39 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|