C53H52O14 — CID 54728892
[(2R,3R,4S,5R,6S)-3,4,5-tribenzoyloxy-6-(3-decoxy-4-hydroxy-2-oxochromen-7-yl)oxyoxan-2-yl]methyl benzoate (PubChem CID 54728892) has the molecular formula C53H52O14 and a molecular weight of 912.98 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-3,4,5-tribenzoyloxy-6-(3-decoxy-4-hydroxy-2-oxochromen-7-yl)oxyoxan-2-yl]methyl benzoate.
| Compound Name | [(2R,3R,4S,5R,6S)-3,4,5-tribenzoyloxy-6-(3-decoxy-4-hydroxy-2-oxochromen-7-yl)oxyoxan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 54728892 |
| Molecular Formula | C53H52O14 |
| Molecular Weight | 912.98 g/mol |
| Exact Mass | 912.34 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-3,4,5-tribenzoyloxy-6-(3-decoxy-4-hydroxy-2-oxochromen-7-yl)oxyoxan-2-yl]methyl benzoate |
| SMILES | CCCCCCCCCCOc1c(O)c2ccc(O[C@@H]3O[C@H](COC(=O)c4ccccc4)[C@@H](OC(=O)c4ccccc4)[C@H](OC(=O)c4ccccc4)[C@H]3OC(=O)c3ccccc3)cc2oc1=O |
| InChI | InChI=1S/C53H52O14/c1-2-3-4-5-6-7-8-21-32-60-45-43(54)40-31-30-39(33-41(40)63-52(45)59)62-53-47(67-51(58)38-28-19-12-20-29-38)46(66-50(57)37-26-17-11-18-27-37)44(65-49(56)36-24-15-10-16-25-36)42(64-53)34-61-48(55)35-22-13-9-14-23-35/h9-20,22-31,33,42,44,46-47,53-54H,2-8,21,32,34H2,1H3/t42-,44-,46+,47-,53-/m1/s1 |
| InChIKey | MIKBQLUOJVULGY-YOGPGSIGSA-N |
| XLogP | 9.66 |
| TPSA | 183.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 67 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 912.98 |
| LogP ≤ 5 | 9.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|