C33H40O14 — CID 54678913
[(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[3-[(2E)-3,7-dimethylocta-2,6-dienoxy]-4-hydroxy-2-oxochromen-7-yl]oxyoxan-2-yl]methyl acetate (PubChem CID 54678913) has the molecular formula C33H40O14 and a molecular weight of 660.67 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[3-[(2E)-3,7-dimethylocta-2,6-dienoxy]-4-hydroxy-2-oxochromen-7-yl]oxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[3-[(2E)-3,7-dimethylocta-2,6-dienoxy]-4-hydroxy-2-oxochromen-7-yl]oxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 54678913 |
| Molecular Formula | C33H40O14 |
| Molecular Weight | 660.67 g/mol |
| Exact Mass | 660.24 |
| IUPAC Name | [(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[3-[(2E)-3,7-dimethylocta-2,6-dienoxy]-4-hydroxy-2-oxochromen-7-yl]oxyoxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](Oc2ccc3c(O)c(OC/C=C(\C)CCC=C(C)C)c(=O)oc3c2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C33H40O14/c1-17(2)9-8-10-18(3)13-14-40-29-27(38)24-12-11-23(15-25(24)46-32(29)39)45-33-31(44-22(7)37)30(43-21(6)36)28(42-20(5)35)26(47-33)16-41-19(4)34/h9,11-13,15,26,28,30-31,33,38H,8,10,14,16H2,1-7H3/b18-13+/t26-,28+,30+,31-,33-/m1/s1 |
| InChIKey | SMVBKDHGGHFNKO-YIFPEADOSA-N |
| XLogP | 4.03 |
| TPSA | 183.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.67 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|