C36H42O14 — CID 54353921
[(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[7-(3,7-dimethylocta-2,6-dienoxy)-2-oxo-3-prop-1-ynoxychromen-4-yl]oxyoxan-2-yl]methyl acetate (PubChem CID 54353921) has the molecular formula C36H42O14 and a molecular weight of 698.72 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[7-(3,7-dimethylocta-2,6-dienoxy)-2-oxo-3-prop-1-ynoxychromen-4-yl]oxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[7-(3,7-dimethylocta-2,6-dienoxy)-2-oxo-3-prop-1-ynoxychromen-4-yl]oxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 54353921 |
| Molecular Formula | C36H42O14 |
| Molecular Weight | 698.72 g/mol |
| Exact Mass | 698.26 |
| IUPAC Name | [(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[7-(3,7-dimethylocta-2,6-dienoxy)-2-oxo-3-prop-1-ynoxychromen-4-yl]oxyoxan-2-yl]methyl acetate |
| SMILES | CC#COc1c(O[C@@H]2O[C@H](COC(C)=O)[C@H](OC(C)=O)[C@H](OC(C)=O)[C@H]2OC(C)=O)c2ccc(OCC=C(C)CCC=C(C)C)cc2oc1=O |
| InChI | InChI=1S/C36H42O14/c1-9-16-43-33-30(27-14-13-26(18-28(27)48-35(33)41)42-17-15-21(4)12-10-11-20(2)3)50-36-34(47-25(8)40)32(46-24(7)39)31(45-23(6)38)29(49-36)19-44-22(5)37/h11,13-15,18,29,31-32,34,36H,10,12,17,19H2,1-8H3/t29-,31+,32+,34-,36+/m1/s1 |
| InChIKey | UHTGTQAMJQPOJS-CZXHOTGTSA-N |
| XLogP | 4.69 |
| TPSA | 172.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.72 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|