C26H30O14 — CID 54735609
[(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-(4-hydroxy-2-oxo-3-propan-2-yloxychromen-7-yl)oxyoxan-2-yl]methyl acetate (PubChem CID 54735609) has the molecular formula C26H30O14 and a molecular weight of 566.51 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-(4-hydroxy-2-oxo-3-propan-2-yloxychromen-7-yl)oxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-(4-hydroxy-2-oxo-3-propan-2-yloxychromen-7-yl)oxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 54735609 |
| Molecular Formula | C26H30O14 |
| Molecular Weight | 566.51 g/mol |
| Exact Mass | 566.16 |
| IUPAC Name | [(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-(4-hydroxy-2-oxo-3-propan-2-yloxychromen-7-yl)oxyoxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](Oc2ccc3c(O)c(OC(C)C)c(=O)oc3c2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C26H30O14/c1-11(2)34-22-20(31)17-8-7-16(9-18(17)39-25(22)32)38-26-24(37-15(6)30)23(36-14(5)29)21(35-13(4)28)19(40-26)10-33-12(3)27/h7-9,11,19,21,23-24,26,31H,10H2,1-6H3/t19-,21+,23+,24-,26-/m1/s1 |
| InChIKey | FSXBBLGZMYTGGU-DLPXPFHCSA-N |
| XLogP | 1.75 |
| TPSA | 183.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.51 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|