C32H32O14 — CID 124712031
[(2S,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methyl-4-oxochromen-7-yl]oxyoxan-2-yl]methyl acetate (PubChem CID 124712031) has the molecular formula C32H32O14 and a molecular weight of 640.59 g/mol. Its IUPAC name is [(2S,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methyl-4-oxochromen-7-yl]oxyoxan-2-yl]methyl acetate.
| Compound Name | [(2S,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methyl-4-oxochromen-7-yl]oxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 124712031 |
| Molecular Formula | C32H32O14 |
| Molecular Weight | 640.59 g/mol |
| Exact Mass | 640.18 |
| IUPAC Name | [(2S,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methyl-4-oxochromen-7-yl]oxyoxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@H]1O[C@H](Oc2ccc3c(=O)c(-c4ccc5c(c4)OCCO5)c(C)oc3c2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C32H32O14/c1-15-27(20-6-9-23-25(12-20)39-11-10-38-23)28(37)22-8-7-21(13-24(22)41-15)45-32-31(44-19(5)36)30(43-18(4)35)29(42-17(3)34)26(46-32)14-40-16(2)33/h6-9,12-13,26,29-32H,10-11,14H2,1-5H3/t26-,29-,30-,31+,32-/m0/s1 |
| InChIKey | VPFJKBXPAREIHK-CJZCYUFNSA-N |
| XLogP | 3.00 |
| TPSA | 172.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.59 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|