C29H29NO12 — CID 98468102
[(2S,3R,4R,5R,6R)-3,4,5-triacetyloxy-6-(2-methyl-4-oxo-3-pyridin-2-ylchromen-7-yl)oxyoxan-2-yl]methyl acetate (PubChem CID 98468102) has the molecular formula C29H29NO12 and a molecular weight of 583.55 g/mol. Its IUPAC name is [(2S,3R,4R,5R,6R)-3,4,5-triacetyloxy-6-(2-methyl-4-oxo-3-pyridin-2-ylchromen-7-yl)oxyoxan-2-yl]methyl acetate.
| Compound Name | [(2S,3R,4R,5R,6R)-3,4,5-triacetyloxy-6-(2-methyl-4-oxo-3-pyridin-2-ylchromen-7-yl)oxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 98468102 |
| Molecular Formula | C29H29NO12 |
| Molecular Weight | 583.55 g/mol |
| Exact Mass | 583.17 |
| IUPAC Name | [(2S,3R,4R,5R,6R)-3,4,5-triacetyloxy-6-(2-methyl-4-oxo-3-pyridin-2-ylchromen-7-yl)oxyoxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@H]1O[C@H](Oc2ccc3c(=O)c(-c4ccccn4)c(C)oc3c2)[C@H](OC(C)=O)[C@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C29H29NO12/c1-14-24(21-8-6-7-11-30-21)25(35)20-10-9-19(12-22(20)37-14)41-29-28(40-18(5)34)27(39-17(4)33)26(38-16(3)32)23(42-29)13-36-15(2)31/h6-12,23,26-29H,13H2,1-5H3/t23-,26+,27+,28+,29-/m0/s1 |
| InChIKey | ARWVTIKJEMLWAI-VOXFHEFUSA-N |
| XLogP | 2.63 |
| TPSA | 166.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.55 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|