C32H36O14 — CID 54539299
[(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-(7-hex-3-enoxy-2-oxo-3-prop-1-ynoxychromen-4-yl)oxyoxan-2-yl]methyl acetate (PubChem CID 54539299) has the molecular formula C32H36O14 and a molecular weight of 644.63 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-(7-hex-3-enoxy-2-oxo-3-prop-1-ynoxychromen-4-yl)oxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-(7-hex-3-enoxy-2-oxo-3-prop-1-ynoxychromen-4-yl)oxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 54539299 |
| Molecular Formula | C32H36O14 |
| Molecular Weight | 644.63 g/mol |
| Exact Mass | 644.21 |
| IUPAC Name | [(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-(7-hex-3-enoxy-2-oxo-3-prop-1-ynoxychromen-4-yl)oxyoxan-2-yl]methyl acetate |
| SMILES | CC#COc1c(O[C@@H]2O[C@H](COC(C)=O)[C@H](OC(C)=O)[C@H](OC(C)=O)[C@H]2OC(C)=O)c2ccc(OCCC=CCC)cc2oc1=O |
| InChI | InChI=1S/C32H36O14/c1-7-9-10-11-15-38-22-12-13-23-24(16-22)44-31(37)29(39-14-8-2)26(23)46-32-30(43-21(6)36)28(42-20(5)35)27(41-19(4)34)25(45-32)17-40-18(3)33/h9-10,12-13,16,25,27-28,30,32H,7,11,15,17H2,1-6H3/t25-,27+,28+,30-,32+/m1/s1 |
| InChIKey | ZBZNQDZBLFLNTL-IEATVXOYSA-N |
| XLogP | 3.35 |
| TPSA | 172.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.63 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|