About 3-chloro-7-hydroxy-4-methylchromen-2-one;hexadecanoic acid
3-chloro-7-hydroxy-4-methylchromen-2-one;hexadecanoic acid (PubChem CID 86592256) has the molecular formula C26H39ClO5
and a molecular weight of 467.05 g/mol. Its IUPAC name is 3-chloro-7-hydroxy-4-methylchromen-2-one;hexadecanoic acid.
Molecular Properties
| Compound Name | 3-chloro-7-hydroxy-4-methylchromen-2-one;hexadecanoic acid |
| PubChem CID | 86592256 |
| Molecular Formula | C26H39ClO5 |
| Molecular Weight | 467.05 g/mol |
| Exact Mass | 466.25 |
| IUPAC Name | 3-chloro-7-hydroxy-4-methylchromen-2-one;hexadecanoic acid |
| SMILES | CCCCCCCCCCCCCCCC(=O)O.Cc1c(Cl)c(=O)oc2cc(O)ccc12 |
| InChI | InChI=1S/C16H32O2.C10H7ClO3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18;1-5-7-3-2-6(12)4-8(7)14-10(13)9(5)11/h2-15H2,1H3,(H,17,18);2-4,12H,1H3 |
| InChIKey | HVEVVWYORZSYEC-UHFFFAOYSA-N |
| XLogP | 8.01 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 467.05 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-7-hydroxy-4-methylchromen-2-one;hexadecanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-7-hydroxy-4-methylchromen-2-one;hexadecanoic acid?
The IUPAC name of 3-chloro-7-hydroxy-4-methylchromen-2-one;hexadecanoic acid (CID 86592256) is 3-chloro-7-hydroxy-4-methylchromen-2-one;hexadecanoic acid.
What is the SMILES notation for 3-chloro-7-hydroxy-4-methylchromen-2-one;hexadecanoic acid?
The canonical SMILES for 3-chloro-7-hydroxy-4-methylchromen-2-one;hexadecanoic acid is CCCCCCCCCCCCCCCC(=O)O.Cc1c(Cl)c(=O)oc2cc(O)ccc12.
What is the InChIKey of 3-chloro-7-hydroxy-4-methylchromen-2-one;hexadecanoic acid?
The InChIKey is HVEVVWYORZSYEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H32O2.C10H7ClO3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18;1-5-7-3-2-6(12)4-8(7)14-10(13)9(5)11/h2-15H2,1H3,(H,17,18);2-4,12H,1H3.
What are the key properties of 3-chloro-7-hydroxy-4-methylchromen-2-one;hexadecanoic acid?
3-chloro-7-hydroxy-4-methylchromen-2-one;hexadecanoic acid has a molecular weight of 467.05 g/mol, XLogP of 8.01, 14 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-7-hydroxy-4-methylchromen-2-one;hexadecanoic acid is sourced from PubChem (CID 86592256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).