About bis(3-chloropropoxy)-oxophosphanium;3-chloro-7-hydroxy-4-methylchromen-2-one
bis(3-chloropropoxy)-oxophosphanium;3-chloro-7-hydroxy-4-methylchromen-2-one (PubChem CID 57350031) has the molecular formula C16H19Cl3O6P+
and a molecular weight of 444.66 g/mol. Its IUPAC name is bis(3-chloropropoxy)-oxophosphanium;3-chloro-7-hydroxy-4-methylchromen-2-one.
Molecular Properties
| Compound Name | bis(3-chloropropoxy)-oxophosphanium;3-chloro-7-hydroxy-4-methylchromen-2-one |
| PubChem CID | 57350031 |
| Molecular Formula | C16H19Cl3O6P+ |
| Molecular Weight | 444.66 g/mol |
| Exact Mass | 443.00 |
| IUPAC Name | bis(3-chloropropoxy)-oxophosphanium;3-chloro-7-hydroxy-4-methylchromen-2-one |
| SMILES | Cc1c(Cl)c(=O)oc2cc(O)ccc12.O=[P+](OCCCCl)OCCCCl |
| InChI | InChI=1S/C10H7ClO3.C6H12Cl2O3P/c1-5-7-3-2-6(12)4-8(7)14-10(13)9(5)11;7-3-1-5-10-12(9)11-6-2-4-8/h2-4,12H,1H3;1-6H2/q;+1 |
| InChIKey | BPYOJRXJVQDJHP-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 85.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 444.66 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze bis(3-chloropropoxy)-oxophosphanium;3-chloro-7-hydroxy-4-methylchromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(3-chloropropoxy)-oxophosphanium;3-chloro-7-hydroxy-4-methylchromen-2-one?
The IUPAC name of bis(3-chloropropoxy)-oxophosphanium;3-chloro-7-hydroxy-4-methylchromen-2-one (CID 57350031) is bis(3-chloropropoxy)-oxophosphanium;3-chloro-7-hydroxy-4-methylchromen-2-one.
What is the SMILES notation for bis(3-chloropropoxy)-oxophosphanium;3-chloro-7-hydroxy-4-methylchromen-2-one?
The canonical SMILES for bis(3-chloropropoxy)-oxophosphanium;3-chloro-7-hydroxy-4-methylchromen-2-one is Cc1c(Cl)c(=O)oc2cc(O)ccc12.O=[P+](OCCCCl)OCCCCl.
What is the InChIKey of bis(3-chloropropoxy)-oxophosphanium;3-chloro-7-hydroxy-4-methylchromen-2-one?
The InChIKey is BPYOJRXJVQDJHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7ClO3.C6H12Cl2O3P/c1-5-7-3-2-6(12)4-8(7)14-10(13)9(5)11;7-3-1-5-10-12(9)11-6-2-4-8/h2-4,12H,1H3;1-6H2/q;+1.
What are the key properties of bis(3-chloropropoxy)-oxophosphanium;3-chloro-7-hydroxy-4-methylchromen-2-one?
bis(3-chloropropoxy)-oxophosphanium;3-chloro-7-hydroxy-4-methylchromen-2-one has a molecular weight of 444.66 g/mol, XLogP of 5.40, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(3-chloropropoxy)-oxophosphanium;3-chloro-7-hydroxy-4-methylchromen-2-one is sourced from PubChem (CID 57350031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).