About (3-chloro-4-methyl-2-oxochromen-7-yl) bis(3-chloropropyl) phosphate
(3-chloro-4-methyl-2-oxochromen-7-yl) bis(3-chloropropyl) phosphate (PubChem CID 20540) has the molecular formula C16H18Cl3O6P
and a molecular weight of 443.65 g/mol. Its IUPAC name is (3-chloro-4-methyl-2-oxochromen-7-yl) bis(3-chloropropyl) phosphate.
Molecular Properties
| Compound Name | (3-chloro-4-methyl-2-oxochromen-7-yl) bis(3-chloropropyl) phosphate |
| PubChem CID | 20540 |
| Molecular Formula | C16H18Cl3O6P |
| Molecular Weight | 443.65 g/mol |
| Exact Mass | 441.99 |
| IUPAC Name | (3-chloro-4-methyl-2-oxochromen-7-yl) bis(3-chloropropyl) phosphate |
| SMILES | Cc1c(Cl)c(=O)oc2cc(OP(=O)(OCCCCl)OCCCCl)ccc12 |
| InChI | InChI=1S/C16H18Cl3O6P/c1-11-13-5-4-12(10-14(13)24-16(20)15(11)19)25-26(21,22-8-2-6-17)23-9-3-7-18/h4-5,10H,2-3,6-9H2,1H3 |
| InChIKey | DLPJKVIZJBVNNT-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 443.65 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (3-chloro-4-methyl-2-oxochromen-7-yl) bis(3-chloropropyl) phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-chloro-4-methyl-2-oxochromen-7-yl) bis(3-chloropropyl) phosphate?
The IUPAC name of (3-chloro-4-methyl-2-oxochromen-7-yl) bis(3-chloropropyl) phosphate (CID 20540) is (3-chloro-4-methyl-2-oxochromen-7-yl) bis(3-chloropropyl) phosphate.
What is the SMILES notation for (3-chloro-4-methyl-2-oxochromen-7-yl) bis(3-chloropropyl) phosphate?
The canonical SMILES for (3-chloro-4-methyl-2-oxochromen-7-yl) bis(3-chloropropyl) phosphate is Cc1c(Cl)c(=O)oc2cc(OP(=O)(OCCCCl)OCCCCl)ccc12.
What is the InChIKey of (3-chloro-4-methyl-2-oxochromen-7-yl) bis(3-chloropropyl) phosphate?
The InChIKey is DLPJKVIZJBVNNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18Cl3O6P/c1-11-13-5-4-12(10-14(13)24-16(20)15(11)19)25-26(21,22-8-2-6-17)23-9-3-7-18/h4-5,10H,2-3,6-9H2,1H3.
What are the key properties of (3-chloro-4-methyl-2-oxochromen-7-yl) bis(3-chloropropyl) phosphate?
(3-chloro-4-methyl-2-oxochromen-7-yl) bis(3-chloropropyl) phosphate has a molecular weight of 443.65 g/mol, XLogP of 5.53, 10 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (3-chloro-4-methyl-2-oxochromen-7-yl) bis(3-chloropropyl) phosphate is sourced from PubChem (CID 20540), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).