C16H17ClLiO11P — CID 58283650
lithium (3-chloro-4-methyl-2-oxochromen-7-yl) (2,3,4,5,6-pentahydroxycyclohexyl) phosphate (PubChem CID 58283650) has the molecular formula C16H17ClLiO11P and a molecular weight of 458.67 g/mol. Its IUPAC name is lithium (3-chloro-4-methyl-2-oxochromen-7-yl) (2,3,4,5,6-pentahydroxycyclohexyl) phosphate.
| Compound Name | lithium (3-chloro-4-methyl-2-oxochromen-7-yl) (2,3,4,5,6-pentahydroxycyclohexyl) phosphate |
|---|---|
| PubChem CID | 58283650 |
| Molecular Formula | C16H17ClLiO11P |
| Molecular Weight | 458.67 g/mol |
| Exact Mass | 458.04 |
| IUPAC Name | lithium (3-chloro-4-methyl-2-oxochromen-7-yl) (2,3,4,5,6-pentahydroxycyclohexyl) phosphate |
| SMILES | Cc1c(Cl)c(=O)oc2cc(OP(=O)([O-])OC3C(O)C(O)C(O)C(O)C3O)ccc12.[Li+] |
| InChI | InChI=1S/C16H18ClO11P.Li/c1-5-7-3-2-6(4-8(7)26-16(23)9(5)17)27-29(24,25)28-15-13(21)11(19)10(18)12(20)14(15)22;/h2-4,10-15,18-22H,1H3,(H,24,25);/q;+1/p-1 |
| InChIKey | BDKSYYXVTOVZCN-UHFFFAOYSA-M |
| XLogP | -4.19 |
| TPSA | 189.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.67 |
| LogP ≤ 5 | -4.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|