About (3-hydroxy-4-methyl-2-oxochromen-7-yl) (4-methyl-2-oxochromen-7-yl) hydrogen phosphate
(3-hydroxy-4-methyl-2-oxochromen-7-yl) (4-methyl-2-oxochromen-7-yl) hydrogen phosphate (PubChem CID 90320061) has the molecular formula C20H15O9P
and a molecular weight of 430.31 g/mol. Its IUPAC name is (3-hydroxy-4-methyl-2-oxochromen-7-yl) (4-methyl-2-oxochromen-7-yl) hydrogen phosphate.
Molecular Properties
| Compound Name | (3-hydroxy-4-methyl-2-oxochromen-7-yl) (4-methyl-2-oxochromen-7-yl) hydrogen phosphate |
| PubChem CID | 90320061 |
| Molecular Formula | C20H15O9P |
| Molecular Weight | 430.31 g/mol |
| Exact Mass | 430.05 |
| IUPAC Name | (3-hydroxy-4-methyl-2-oxochromen-7-yl) (4-methyl-2-oxochromen-7-yl) hydrogen phosphate |
| SMILES | Cc1cc(=O)oc2cc(OP(=O)(O)Oc3ccc4c(C)c(O)c(=O)oc4c3)ccc12 |
| InChI | InChI=1S/C20H15O9P/c1-10-7-18(21)26-16-8-12(3-5-14(10)16)28-30(24,25)29-13-4-6-15-11(2)19(22)20(23)27-17(15)9-13/h3-9,22H,1-2H3,(H,24,25) |
| InChIKey | WOUGZDPSDDLFJO-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 136.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 430.31 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (3-hydroxy-4-methyl-2-oxochromen-7-yl) (4-methyl-2-oxochromen-7-yl) hydrogen phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-hydroxy-4-methyl-2-oxochromen-7-yl) (4-methyl-2-oxochromen-7-yl) hydrogen phosphate?
The IUPAC name of (3-hydroxy-4-methyl-2-oxochromen-7-yl) (4-methyl-2-oxochromen-7-yl) hydrogen phosphate (CID 90320061) is (3-hydroxy-4-methyl-2-oxochromen-7-yl) (4-methyl-2-oxochromen-7-yl) hydrogen phosphate.
What is the SMILES notation for (3-hydroxy-4-methyl-2-oxochromen-7-yl) (4-methyl-2-oxochromen-7-yl) hydrogen phosphate?
The canonical SMILES for (3-hydroxy-4-methyl-2-oxochromen-7-yl) (4-methyl-2-oxochromen-7-yl) hydrogen phosphate is Cc1cc(=O)oc2cc(OP(=O)(O)Oc3ccc4c(C)c(O)c(=O)oc4c3)ccc12.
What is the InChIKey of (3-hydroxy-4-methyl-2-oxochromen-7-yl) (4-methyl-2-oxochromen-7-yl) hydrogen phosphate?
The InChIKey is WOUGZDPSDDLFJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15O9P/c1-10-7-18(21)26-16-8-12(3-5-14(10)16)28-30(24,25)29-13-4-6-15-11(2)19(22)20(23)27-17(15)9-13/h3-9,22H,1-2H3,(H,24,25).
What are the key properties of (3-hydroxy-4-methyl-2-oxochromen-7-yl) (4-methyl-2-oxochromen-7-yl) hydrogen phosphate?
(3-hydroxy-4-methyl-2-oxochromen-7-yl) (4-methyl-2-oxochromen-7-yl) hydrogen phosphate has a molecular weight of 430.31 g/mol, XLogP of 3.78, 4 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for (3-hydroxy-4-methyl-2-oxochromen-7-yl) (4-methyl-2-oxochromen-7-yl) hydrogen phosphate is sourced from PubChem (CID 90320061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).